C18H17FN6O3S — CID 175973689
6-[(6-fluoro-2-pyridinyl)amino]-2-[2-(methanesulfonamido)anilino]pyridine-3-carboxamide (PubChem CID 175973689) has the molecular formula C18H17FN6O3S and a molecular weight of 416.44 g/mol. Its IUPAC name is 6-[(6-fluoro-2-pyridinyl)amino]-2-[2-(methanesulfonamido)anilino]pyridine-3-carboxamide.
| Compound Name | 6-[(6-fluoro-2-pyridinyl)amino]-2-[2-(methanesulfonamido)anilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175973689 |
| Molecular Formula | C18H17FN6O3S |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 6-[(6-fluoro-2-pyridinyl)amino]-2-[2-(methanesulfonamido)anilino]pyridine-3-carboxamide |
| SMILES | CS(=O)(=O)Nc1ccccc1Nc1nc(Nc2cccc(F)n2)ccc1C(N)=O |
| InChI | InChI=1S/C18H17FN6O3S/c1-29(27,28)25-13-6-3-2-5-12(13)21-18-11(17(20)26)9-10-16(24-18)23-15-8-4-7-14(19)22-15/h2-10,25H,1H3,(H2,20,26)(H2,21,22,23,24) |
| InChIKey | KHLQKXHBMFOFQG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 139.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|