C21H30N6O2 — CID 175976213
ethyl 1-[3-(3,5-diamino-1,2,4-triazol-1-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl]piperidine-4-carboxylate (PubChem CID 175976213) has the molecular formula C21H30N6O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is ethyl 1-[3-(3,5-diamino-1,2,4-triazol-1-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-(3,5-diamino-1,2,4-triazol-1-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 175976213 |
| Molecular Formula | C21H30N6O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | ethyl 1-[3-(3,5-diamino-1,2,4-triazol-1-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C2CCc3ccc(-n4nc(N)nc4N)cc3CC2)CC1 |
| InChI | InChI=1S/C21H30N6O2/c1-2-29-19(28)15-9-11-26(12-10-15)17-6-3-14-4-8-18(13-16(14)5-7-17)27-21(23)24-20(22)25-27/h4,8,13,15,17H,2-3,5-7,9-12H2,1H3,(H4,22,23,24,25) |
| InChIKey | PQUYORVCGBVROG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |