C16H23F3N4O2S — CID 175980952
(3R,3aR,6aR)-3-tert-butyl-5-[4-methyl-2-(trifluoromethyl)pyrimidin-5-yl]sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 175980952) has the molecular formula C16H23F3N4O2S and a molecular weight of 392.45 g/mol. Its IUPAC name is (3R,3aR,6aR)-3-tert-butyl-5-[4-methyl-2-(trifluoromethyl)pyrimidin-5-yl]sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | (3R,3aR,6aR)-3-tert-butyl-5-[4-methyl-2-(trifluoromethyl)pyrimidin-5-yl]sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 175980952 |
| Molecular Formula | C16H23F3N4O2S |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | (3R,3aR,6aR)-3-tert-butyl-5-[4-methyl-2-(trifluoromethyl)pyrimidin-5-yl]sulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | Cc1nc(C(F)(F)F)ncc1S(=O)(=O)N1C[C@H]2CN[C@@H](C(C)(C)C)[C@H]2C1 |
| InChI | InChI=1S/C16H23F3N4O2S/c1-9-12(6-21-14(22-9)16(17,18)19)26(24,25)23-7-10-5-20-13(11(10)8-23)15(2,3)4/h6,10-11,13,20H,5,7-8H2,1-4H3/t10-,11+,13-/m1/s1 |
| InChIKey | AIIVMEPYLRXZBQ-NTZNESFSSA-N |
| XLogP | 2.06 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |