C14H17FN2O3S — CID 133139615
(3aR,7R,7aS)-2-(4-fluorophenyl)sulfonyl-7-methyl-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-6-one (PubChem CID 133139615) has the molecular formula C14H17FN2O3S and a molecular weight of 312.37 g/mol. Its IUPAC name is (3aR,7R,7aS)-2-(4-fluorophenyl)sulfonyl-7-methyl-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-6-one.
| Compound Name | (3aR,7R,7aS)-2-(4-fluorophenyl)sulfonyl-7-methyl-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-6-one |
|---|---|
| PubChem CID | 133139615 |
| Molecular Formula | C14H17FN2O3S |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | (3aR,7R,7aS)-2-(4-fluorophenyl)sulfonyl-7-methyl-3,3a,4,5,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-6-one |
| SMILES | C[C@H]1C(=O)NC[C@@H]2CN(S(=O)(=O)c3ccc(F)cc3)C[C@@H]21 |
| InChI | InChI=1S/C14H17FN2O3S/c1-9-13-8-17(7-10(13)6-16-14(9)18)21(19,20)12-4-2-11(15)3-5-12/h2-5,9-10,13H,6-8H2,1H3,(H,16,18)/t9-,10-,13-/m1/s1 |
| InChIKey | YCCQBSOCGOUPBD-GIPNMCIBSA-N |
| XLogP | 0.83 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |