C15H24F3NO6S — CID 175981452
tert-butyl 2-[3-(trifluoromethylsulfonyloxy)cyclobutyl]oxypiperidine-1-carboxylate (PubChem CID 175981452) has the molecular formula C15H24F3NO6S and a molecular weight of 403.42 g/mol. Its IUPAC name is tert-butyl 2-[3-(trifluoromethylsulfonyloxy)cyclobutyl]oxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[3-(trifluoromethylsulfonyloxy)cyclobutyl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 175981452 |
| Molecular Formula | C15H24F3NO6S |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | tert-butyl 2-[3-(trifluoromethylsulfonyloxy)cyclobutyl]oxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1OC1CC(OS(=O)(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C15H24F3NO6S/c1-14(2,3)24-13(20)19-7-5-4-6-12(19)23-10-8-11(9-10)25-26(21,22)15(16,17)18/h10-12H,4-9H2,1-3H3 |
| InChIKey | WTXQCADOMWZAIL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|