C12H9N3O3S2 — CID 175982069
1,1-dioxo-N-pyridin-2-yl-2H-thieno[3,2-e]thiazine-3-carboxamide (PubChem CID 175982069) has the molecular formula C12H9N3O3S2 and a molecular weight of 307.36 g/mol. Its IUPAC name is 1,1-dioxo-N-pyridin-2-yl-2H-thieno[3,2-e]thiazine-3-carboxamide.
| Compound Name | 1,1-dioxo-N-pyridin-2-yl-2H-thieno[3,2-e]thiazine-3-carboxamide |
|---|---|
| PubChem CID | 175982069 |
| Molecular Formula | C12H9N3O3S2 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | 1,1-dioxo-N-pyridin-2-yl-2H-thieno[3,2-e]thiazine-3-carboxamide |
| SMILES | O=C(Nc1ccccn1)C1=Cc2ccsc2S(=O)(=O)N1 |
| InChI | InChI=1S/C12H9N3O3S2/c16-11(14-10-3-1-2-5-13-10)9-7-8-4-6-19-12(8)20(17,18)15-9/h1-7,15H,(H,13,14,16) |
| InChIKey | PLTIJZXHRFBITG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |