C12H22O7 — CID 175982190
(2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxododecanoic acid (PubChem CID 175982190) has the molecular formula C12H22O7 and a molecular weight of 278.30 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxododecanoic acid.
| Compound Name | (2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxododecanoic acid |
|---|---|
| PubChem CID | 175982190 |
| Molecular Formula | C12H22O7 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxododecanoic acid |
| SMILES | CCCCCCC(=O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(=O)O |
| InChI | InChI=1S/C12H22O7/c1-2-3-4-5-6-7(13)8(14)9(15)10(16)11(17)12(18)19/h8-11,14-17H,2-6H2,1H3,(H,18,19)/t8-,9+,10+,11-/m0/s1 |
| InChIKey | CRESPFDWXYBGDV-ZDCRXTMVSA-N |
| XLogP | -0.95 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|