C15H11Cl2FN2O3 — CID 175982335
3-[5-[(2,6-dichloro-3-fluorophenyl)methoxy]-2-pyridinyl]-1,3-oxazolidin-2-one (PubChem CID 175982335) has the molecular formula C15H11Cl2FN2O3 and a molecular weight of 357.17 g/mol. Its IUPAC name is 3-[5-[(2,6-dichloro-3-fluorophenyl)methoxy]-2-pyridinyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[5-[(2,6-dichloro-3-fluorophenyl)methoxy]-2-pyridinyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 175982335 |
| Molecular Formula | C15H11Cl2FN2O3 |
| Molecular Weight | 357.17 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 3-[5-[(2,6-dichloro-3-fluorophenyl)methoxy]-2-pyridinyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1c1ccc(OCc2c(Cl)ccc(F)c2Cl)cn1 |
| InChI | InChI=1S/C15H11Cl2FN2O3/c16-11-2-3-12(18)14(17)10(11)8-23-9-1-4-13(19-7-9)20-5-6-22-15(20)21/h1-4,7H,5-6,8H2 |
| InChIKey | WHBOXAWVWVZOKZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.17 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|