C15H19N3O6S — CID 175982539
2-(2,5-dioxopyrrolidin-1-yl)-6-(2-methylsulfonylpyrimidin-5-yl)hexanoic acid (PubChem CID 175982539) has the molecular formula C15H19N3O6S and a molecular weight of 369.40 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrolidin-1-yl)-6-(2-methylsulfonylpyrimidin-5-yl)hexanoic acid.
| Compound Name | 2-(2,5-dioxopyrrolidin-1-yl)-6-(2-methylsulfonylpyrimidin-5-yl)hexanoic acid |
|---|---|
| PubChem CID | 175982539 |
| Molecular Formula | C15H19N3O6S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2-(2,5-dioxopyrrolidin-1-yl)-6-(2-methylsulfonylpyrimidin-5-yl)hexanoic acid |
| SMILES | CS(=O)(=O)c1ncc(CCCCC(C(=O)O)N2C(=O)CCC2=O)cn1 |
| InChI | InChI=1S/C15H19N3O6S/c1-25(23,24)15-16-8-10(9-17-15)4-2-3-5-11(14(21)22)18-12(19)6-7-13(18)20/h8-9,11H,2-7H2,1H3,(H,21,22) |
| InChIKey | IZACZTWNKZUSTH-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 134.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|