C20H24N2O15S — CID 87642680
4-[2-[3-carboxy-3-(2,5-dioxopyrrolidin-1-yl)propanoyl]oxyethoxy]-2-(2,5-dioxopyrrolidin-1-yl)-4-oxobutanoic acid;ethenesulfonic acid (PubChem CID 87642680) has the molecular formula C20H24N2O15S and a molecular weight of 564.48 g/mol. Its IUPAC name is 4-[2-[3-carboxy-3-(2,5-dioxopyrrolidin-1-yl)propanoyl]oxyethoxy]-2-(2,5-dioxopyrrolidin-1-yl)-4-oxobutanoic acid;ethenesulfonic acid.
| Compound Name | 4-[2-[3-carboxy-3-(2,5-dioxopyrrolidin-1-yl)propanoyl]oxyethoxy]-2-(2,5-dioxopyrrolidin-1-yl)-4-oxobutanoic acid;ethenesulfonic acid |
|---|---|
| PubChem CID | 87642680 |
| Molecular Formula | C20H24N2O15S |
| Molecular Weight | 564.48 g/mol |
| Exact Mass | 564.09 |
| IUPAC Name | 4-[2-[3-carboxy-3-(2,5-dioxopyrrolidin-1-yl)propanoyl]oxyethoxy]-2-(2,5-dioxopyrrolidin-1-yl)-4-oxobutanoic acid;ethenesulfonic acid |
| SMILES | C=CS(=O)(=O)O.O=C(CC(C(=O)O)N1C(=O)CCC1=O)OCCOC(=O)CC(C(=O)O)N1C(=O)CCC1=O |
| InChI | InChI=1S/C18H20N2O12.C2H4O3S/c21-11-1-2-12(22)19(11)9(17(27)28)7-15(25)31-5-6-32-16(26)8-10(18(29)30)20-13(23)3-4-14(20)24;1-2-6(3,4)5/h9-10H,1-8H2,(H,27,28)(H,29,30);2H,1H2,(H,3,4,5) |
| InChIKey | KOAZWJSYYLVQOY-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 256.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.48 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|