C17H22N2O9 — CID 146298855
2-(2,5-dioxopyrrolidin-1-yl)-3-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]propanoic acid (PubChem CID 146298855) has the molecular formula C17H22N2O9 and a molecular weight of 398.37 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrolidin-1-yl)-3-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]propanoic acid.
| Compound Name | 2-(2,5-dioxopyrrolidin-1-yl)-3-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 146298855 |
| Molecular Formula | C17H22N2O9 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 2-(2,5-dioxopyrrolidin-1-yl)-3-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]propanoic acid |
| SMILES | O=C(O)C(COCCOCCOCCN1C(=O)C=CC1=O)N1C(=O)CCC1=O |
| InChI | InChI=1S/C17H22N2O9/c20-13-1-2-14(21)18(13)5-6-26-7-8-27-9-10-28-11-12(17(24)25)19-15(22)3-4-16(19)23/h1-2,12H,3-11H2,(H,24,25) |
| InChIKey | GADUBNOUGGRRAF-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 139.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|