C17H22BrNO2 — CID 175986585
tert-butyl 2-[(3-bromophenyl)methylidene]piperidine-1-carboxylate (PubChem CID 175986585) has the molecular formula C17H22BrNO2 and a molecular weight of 352.27 g/mol. Its IUPAC name is tert-butyl 2-[(3-bromophenyl)methylidene]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(3-bromophenyl)methylidene]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175986585 |
| Molecular Formula | C17H22BrNO2 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | tert-butyl 2-[(3-bromophenyl)methylidene]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1=Cc1cccc(Br)c1 |
| InChI | InChI=1S/C17H22BrNO2/c1-17(2,3)21-16(20)19-10-5-4-9-15(19)12-13-7-6-8-14(18)11-13/h6-8,11-12H,4-5,9-10H2,1-3H3 |
| InChIKey | AUGRVMWGHGNFQI-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |