C17H22FNO2S — CID 145138542
tert-butyl (2E)-2-[[4-fluoro-2-(sulfanylmethyl)phenyl]methylidene]pyrrolidine-1-carboxylate (PubChem CID 145138542) has the molecular formula C17H22FNO2S and a molecular weight of 323.43 g/mol. Its IUPAC name is tert-butyl (2E)-2-[[4-fluoro-2-(sulfanylmethyl)phenyl]methylidene]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2E)-2-[[4-fluoro-2-(sulfanylmethyl)phenyl]methylidene]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 145138542 |
| Molecular Formula | C17H22FNO2S |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | tert-butyl (2E)-2-[[4-fluoro-2-(sulfanylmethyl)phenyl]methylidene]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC/C1=C\c1ccc(F)cc1CS |
| InChI | InChI=1S/C17H22FNO2S/c1-17(2,3)21-16(20)19-8-4-5-15(19)10-12-6-7-14(18)9-13(12)11-22/h6-7,9-10,22H,4-5,8,11H2,1-3H3/b15-10+ |
| InChIKey | KNQCFEPTSSJBPW-XNTDXEJSSA-N |
| XLogP | 4.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|