C59H69N — CID 175988123
2,6-bis[2-[3-(1-adamantyl)-5-tert-butylphenyl]-5-methylphenyl]pyridine (PubChem CID 175988123) has the molecular formula C59H69N and a molecular weight of 792.21 g/mol. Its IUPAC name is 2,6-bis[2-[3-(1-adamantyl)-5-tert-butylphenyl]-5-methylphenyl]pyridine.
| Compound Name | 2,6-bis[2-[3-(1-adamantyl)-5-tert-butylphenyl]-5-methylphenyl]pyridine |
|---|---|
| PubChem CID | 175988123 |
| Molecular Formula | C59H69N |
| Molecular Weight | 792.21 g/mol |
| Exact Mass | 791.54 |
| IUPAC Name | 2,6-bis[2-[3-(1-adamantyl)-5-tert-butylphenyl]-5-methylphenyl]pyridine |
| SMILES | Cc1ccc(-c2cc(C(C)(C)C)cc(C34CC5CC(CC(C5)C3)C4)c2)c(-c2cccc(-c3cc(C)ccc3-c3cc(C(C)(C)C)cc(C45CC6CC(CC(C6)C4)C5)c3)n2)c1 |
| InChI | InChI=1S/C59H69N/c1-36-12-14-50(44-24-46(56(3,4)5)28-48(26-44)58-30-38-18-39(31-58)20-40(19-38)32-58)52(16-36)54-10-9-11-55(60-54)53-17-37(2)13-15-51(53)45-25-47(57(6,7)8)29-49(27-45)59-33-41-21-42(34-59)23-43(22-41)35-59/h9-17,24-29,38-43H,18-23,30-35H2,1-8H3 |
| InChIKey | VXBUTTWQOPYEOU-UHFFFAOYSA-N |
| XLogP | 15.90 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.21 |
| LogP ≤ 5 | 15.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |