C29H38 — CID 175988138
1-[3-tert-butyl-5-(4-propan-2-ylphenyl)phenyl]adamantane (PubChem CID 175988138) has the molecular formula C29H38 and a molecular weight of 386.62 g/mol. Its IUPAC name is 1-[3-tert-butyl-5-(4-propan-2-ylphenyl)phenyl]adamantane.
| Compound Name | 1-[3-tert-butyl-5-(4-propan-2-ylphenyl)phenyl]adamantane |
|---|---|
| PubChem CID | 175988138 |
| Molecular Formula | C29H38 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | 1-[3-tert-butyl-5-(4-propan-2-ylphenyl)phenyl]adamantane |
| SMILES | CC(C)c1ccc(-c2cc(C(C)(C)C)cc(C34CC5CC(CC(C5)C3)C4)c2)cc1 |
| InChI | InChI=1S/C29H38/c1-19(2)23-6-8-24(9-7-23)25-13-26(28(3,4)5)15-27(14-25)29-16-20-10-21(17-29)12-22(11-20)18-29/h6-9,13-15,19-22H,10-12,16-18H2,1-5H3 |
| InChIKey | VNGWFVSXDZKHKX-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |