C25H30F3N5O2 — CID 175988418
(2S)-1-acetyl-2-amino-N-[(1S)-1-[5-[[(2S)-3,3-dimethyl-1,2-dihydroinden-2-yl]amino]-2-pyridinyl]-2,2,2-trifluoroethyl]pyrrolidine-3-carboxamide (PubChem CID 175988418) has the molecular formula C25H30F3N5O2 and a molecular weight of 489.54 g/mol. Its IUPAC name is (2S)-1-acetyl-2-amino-N-[(1S)-1-[5-[[(2S)-3,3-dimethyl-1,2-dihydroinden-2-yl]amino]-2-pyridinyl]-2,2,2-trifluoroethyl]pyrrolidine-3-carboxamide.
| Compound Name | (2S)-1-acetyl-2-amino-N-[(1S)-1-[5-[[(2S)-3,3-dimethyl-1,2-dihydroinden-2-yl]amino]-2-pyridinyl]-2,2,2-trifluoroethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 175988418 |
| Molecular Formula | C25H30F3N5O2 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | (2S)-1-acetyl-2-amino-N-[(1S)-1-[5-[[(2S)-3,3-dimethyl-1,2-dihydroinden-2-yl]amino]-2-pyridinyl]-2,2,2-trifluoroethyl]pyrrolidine-3-carboxamide |
| SMILES | CC(=O)N1CCC(C(=O)N[C@@H](c2ccc(N[C@H]3Cc4ccccc4C3(C)C)cn2)C(F)(F)F)[C@H]1N |
| InChI | InChI=1S/C25H30F3N5O2/c1-14(34)33-11-10-17(22(33)29)23(35)32-21(25(26,27)28)19-9-8-16(13-30-19)31-20-12-15-6-4-5-7-18(15)24(20,2)3/h4-9,13,17,20-22,31H,10-12,29H2,1-3H3,(H,32,35)/t17?,20-,21-,22-/m0/s1 |
| InChIKey | YITSWOUFZRNOIV-LOOWFBELSA-N |
| XLogP | 3.27 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |