C14H12N4OS — CID 176516670
(4R)-2-amino-5-(iminomethylidene)-4-(2-methoxyphenyl)-6-sulfanylidene-3,4-dihydropyridine-3-carbonitrile (PubChem CID 176516670) has the molecular formula C14H12N4OS and a molecular weight of 284.34 g/mol. Its IUPAC name is (4R)-2-amino-5-(iminomethylidene)-4-(2-methoxyphenyl)-6-sulfanylidene-3,4-dihydropyridine-3-carbonitrile.
| Compound Name | (4R)-2-amino-5-(iminomethylidene)-4-(2-methoxyphenyl)-6-sulfanylidene-3,4-dihydropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 176516670 |
| Molecular Formula | C14H12N4OS |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | (4R)-2-amino-5-(iminomethylidene)-4-(2-methoxyphenyl)-6-sulfanylidene-3,4-dihydropyridine-3-carbonitrile |
| SMILES | COc1ccccc1[C@@H]1C(=C=N)C(=S)N=C(N)C1C#N |
| InChI | InChI=1S/C14H12N4OS/c1-19-11-5-3-2-4-8(11)12-9(6-15)13(17)18-14(20)10(12)7-16/h2-5,9,12,16H,1H3,(H2,17,18,20)/t9?,12-/m0/s1 |
| InChIKey | KVJCAZXFEWKPBB-ACGXKRRESA-N |
| XLogP | 1.79 |
| TPSA | 95.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|