C11H15N3O — CID 176519548
N-[2-(4-ethylpyrazol-1-yl)ethyl]buta-2,3-dienamide (PubChem CID 176519548) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is N-[2-(4-ethylpyrazol-1-yl)ethyl]buta-2,3-dienamide.
| Compound Name | N-[2-(4-ethylpyrazol-1-yl)ethyl]buta-2,3-dienamide |
|---|---|
| PubChem CID | 176519548 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | N-[2-(4-ethylpyrazol-1-yl)ethyl]buta-2,3-dienamide |
| SMILES | C=C=CC(=O)NCCn1cc(CC)cn1 |
| InChI | InChI=1S/C11H15N3O/c1-3-5-11(15)12-6-7-14-9-10(4-2)8-13-14/h5,8-9H,1,4,6-7H2,2H3,(H,12,15) |
| InChIKey | IUJTWQVUEPBIPS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|