C11H15N — CID 176520993
(2E)-2-[(Z)-but-2-enylidene]-3-ethenylidenepiperidine (PubChem CID 176520993) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is (2E)-2-[(Z)-but-2-enylidene]-3-ethenylidenepiperidine.
| Compound Name | (2E)-2-[(Z)-but-2-enylidene]-3-ethenylidenepiperidine |
|---|---|
| PubChem CID | 176520993 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (2E)-2-[(Z)-but-2-enylidene]-3-ethenylidenepiperidine |
| SMILES | C=C=C1CCCN/C1=C/C=C\C |
| InChI | InChI=1S/C11H15N/c1-3-5-8-11-10(4-2)7-6-9-12-11/h3,5,8,12H,2,6-7,9H2,1H3/b5-3-,11-8+ |
| InChIKey | QLKNCVAVUJHDAY-NJHUYJSNSA-N |
| XLogP | 2.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |