C23H19NO3S — CID 176522416
methyl 6-methyl-3-oxo-1-(3-phenylsulfanylphenyl)-2H-isoindole-1-carboxylate (PubChem CID 176522416) has the molecular formula C23H19NO3S and a molecular weight of 389.48 g/mol. Its IUPAC name is methyl 6-methyl-3-oxo-1-(3-phenylsulfanylphenyl)-2H-isoindole-1-carboxylate.
| Compound Name | methyl 6-methyl-3-oxo-1-(3-phenylsulfanylphenyl)-2H-isoindole-1-carboxylate |
|---|---|
| PubChem CID | 176522416 |
| Molecular Formula | C23H19NO3S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | methyl 6-methyl-3-oxo-1-(3-phenylsulfanylphenyl)-2H-isoindole-1-carboxylate |
| SMILES | COC(=O)C1(c2cccc(Sc3ccccc3)c2)NC(=O)c2ccc(C)cc21 |
| InChI | InChI=1S/C23H19NO3S/c1-15-11-12-19-20(13-15)23(22(26)27-2,24-21(19)25)16-7-6-10-18(14-16)28-17-8-4-3-5-9-17/h3-14H,1-2H3,(H,24,25) |
| InChIKey | BNAWZFDJQUKQJA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |