C16H12ClNO3 — CID 176522432
methyl 1-(4-chlorophenyl)-3-oxo-2H-isoindole-1-carboxylate (PubChem CID 176522432) has the molecular formula C16H12ClNO3 and a molecular weight of 301.73 g/mol. Its IUPAC name is methyl 1-(4-chlorophenyl)-3-oxo-2H-isoindole-1-carboxylate.
| Compound Name | methyl 1-(4-chlorophenyl)-3-oxo-2H-isoindole-1-carboxylate |
|---|---|
| PubChem CID | 176522432 |
| Molecular Formula | C16H12ClNO3 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | methyl 1-(4-chlorophenyl)-3-oxo-2H-isoindole-1-carboxylate |
| SMILES | COC(=O)C1(c2ccc(Cl)cc2)NC(=O)c2ccccc21 |
| InChI | InChI=1S/C16H12ClNO3/c1-21-15(20)16(10-6-8-11(17)9-7-10)13-5-3-2-4-12(13)14(19)18-16/h2-9H,1H3,(H,18,19) |
| InChIKey | AUELIDGCZBUPRO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |