About CID 176522512
CID 176522512 (PubChem CID 176522512) has the molecular formula C11H21BN5O2
and a molecular weight of 266.13 g/mol.
Molecular Properties
| Compound Name | CID 176522512 |
| PubChem CID | 176522512 |
| Molecular Formula | C11H21BN5O2 |
| Molecular Weight | 266.13 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | — |
| SMILES | [H]/N=C(N)/C(/N=C/C([B]OC(C)(C)C(C)(C)O)=CN)=N\[H] |
| InChI | InChI=1S/C11H21BN5O2/c1-10(2,18)11(3,4)19-12-7(5-13)6-17-9(16)8(14)15/h5-6,16,18H,13H2,1-4H3,(H3,14,15)/b7-5?,16-9+,17-6+ |
| InChIKey | TYCUXRJEGTVGBE-NWGCTGMCSA-N |
| XLogP | -0.04 |
| TPSA | 141.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.13 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze CID 176522512 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176522512?
The IUPAC name of CID 176522512 (CID 176522512) is not available.
What is the SMILES notation for CID 176522512?
The canonical SMILES for CID 176522512 is [H]/N=C(N)/C(/N=C/C([B]OC(C)(C)C(C)(C)O)=CN)=N\[H].
What is the InChIKey of CID 176522512?
The InChIKey is TYCUXRJEGTVGBE-NWGCTGMCSA-N. The full InChI is InChI=1S/C11H21BN5O2/c1-10(2,18)11(3,4)19-12-7(5-13)6-17-9(16)8(14)15/h5-6,16,18H,13H2,1-4H3,(H3,14,15)/b7-5?,16-9+,17-6+.
What are the key properties of CID 176522512?
CID 176522512 has a molecular weight of 266.13 g/mol, XLogP of -0.04, 5 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176522512 is sourced from PubChem (CID 176522512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).