C13H26ClN5 — CID 176525992
N-(N'-hexylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide;hydrochloride (PubChem CID 176525992) has the molecular formula C13H26ClN5 and a molecular weight of 287.84 g/mol. Its IUPAC name is N-(N'-hexylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide;hydrochloride.
| Compound Name | N-(N'-hexylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 176525992 |
| Molecular Formula | C13H26ClN5 |
| Molecular Weight | 287.84 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | N-(N'-hexylcarbamimidoyl)-3,6-dihydro-2H-pyridine-1-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N/C(N)=N/CCCCCC)N1CC=CCC1 |
| InChI | InChI=1S/C13H25N5.ClH/c1-2-3-4-6-9-16-12(14)17-13(15)18-10-7-5-8-11-18;/h5,7H,2-4,6,8-11H2,1H3,(H4,14,15,16,17);1H |
| InChIKey | ZZVCFSBHPLMYAX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.84 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|