C8H6Cl2N4 — CID 176531046
N-(2,5-dichloro-4-cyanoiminocyclohexa-2,5-dien-1-yl)methanimidamide (PubChem CID 176531046) has the molecular formula C8H6Cl2N4 and a molecular weight of 229.07 g/mol. Its IUPAC name is N-(2,5-dichloro-4-cyanoiminocyclohexa-2,5-dien-1-yl)methanimidamide.
| Compound Name | N-(2,5-dichloro-4-cyanoiminocyclohexa-2,5-dien-1-yl)methanimidamide |
|---|---|
| PubChem CID | 176531046 |
| Molecular Formula | C8H6Cl2N4 |
| Molecular Weight | 229.07 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | N-(2,5-dichloro-4-cyanoiminocyclohexa-2,5-dien-1-yl)methanimidamide |
| SMILES | [H]/N=C/NC1C=C(Cl)/C(=N/C#N)C=C1Cl |
| InChI | InChI=1S/C8H6Cl2N4/c9-5-1-7(13-3-11)6(10)2-8(5)14-4-12/h1-3,7H,(H2,11,13)/b14-8+ |
| InChIKey | GLBYYOFDAOYOFY-RIYZIHGNSA-N |
| XLogP | 1.73 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.07 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|