C6H6N6 — CID 176528061
N-[(Z)-1,2-dicyano-2-methanimidamidoethenyl]methanimidamide (PubChem CID 176528061) has the molecular formula C6H6N6 and a molecular weight of 162.16 g/mol. Its IUPAC name is N-[(Z)-1,2-dicyano-2-methanimidamidoethenyl]methanimidamide.
| Compound Name | N-[(Z)-1,2-dicyano-2-methanimidamidoethenyl]methanimidamide |
|---|---|
| PubChem CID | 176528061 |
| Molecular Formula | C6H6N6 |
| Molecular Weight | 162.16 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | N-[(Z)-1,2-dicyano-2-methanimidamidoethenyl]methanimidamide |
| SMILES | [H]/N=C/N/C(C#N)=C(/C#N)N/C=N/[H] |
| InChI | InChI=1S/C6H6N6/c7-1-5(11-3-9)6(2-8)12-4-10/h3-4H,(H2,9,11)(H2,10,12)/b6-5- |
| InChIKey | VBTPTIXCXHYGHO-WAYWQWQTSA-N |
| XLogP | -0.36 |
| TPSA | 119.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.16 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|