C11H4N4O3 — CID 122592259
(2E)-2-[(3Z)-3-(1-cyano-2-iminoethylidene)-2,4,5-trioxocyclopentylidene]-3-iminopropanenitrile (PubChem CID 122592259) has the molecular formula C11H4N4O3 and a molecular weight of 240.18 g/mol. Its IUPAC name is (2E)-2-[(3Z)-3-(1-cyano-2-iminoethylidene)-2,4,5-trioxocyclopentylidene]-3-iminopropanenitrile.
| Compound Name | (2E)-2-[(3Z)-3-(1-cyano-2-iminoethylidene)-2,4,5-trioxocyclopentylidene]-3-iminopropanenitrile |
|---|---|
| PubChem CID | 122592259 |
| Molecular Formula | C11H4N4O3 |
| Molecular Weight | 240.18 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | (2E)-2-[(3Z)-3-(1-cyano-2-iminoethylidene)-2,4,5-trioxocyclopentylidene]-3-iminopropanenitrile |
| SMILES | [H]/N=C/C(C#N)=c1/c(=O)c(=O)/c(=C(C#N)\C=N\[H])c1=O |
| InChI | InChI=1S/C11H4N4O3/c12-1-5(2-13)7-9(16)8(6(3-14)4-15)11(18)10(7)17/h1,3,12,14H/b7-5-,8-6+,12-1+,14-3+ |
| InChIKey | BEWXQBZVKOPUQM-UIMABSBGSA-N |
| XLogP | -2.71 |
| TPSA | 146.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.18 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|