C16H11NO3S — CID 176531549
2-(naphthalen-2-ylamino)-4-(oxomethylidene)thiophene-3-carboxylic acid (PubChem CID 176531549) has the molecular formula C16H11NO3S and a molecular weight of 297.34 g/mol. Its IUPAC name is 2-(naphthalen-2-ylamino)-4-(oxomethylidene)thiophene-3-carboxylic acid.
| Compound Name | 2-(naphthalen-2-ylamino)-4-(oxomethylidene)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 176531549 |
| Molecular Formula | C16H11NO3S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 2-(naphthalen-2-ylamino)-4-(oxomethylidene)thiophene-3-carboxylic acid |
| SMILES | O=C=C1CSC(Nc2ccc3ccccc3c2)=C1C(=O)O |
| InChI | InChI=1S/C16H11NO3S/c18-8-12-9-21-15(14(12)16(19)20)17-13-6-5-10-3-1-2-4-11(10)7-13/h1-7,17H,9H2,(H,19,20) |
| InChIKey | FCVPBRFNEZIXAP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|