C15H15NO3S — CID 176531550
methyl 2-(3,4-dimethylanilino)-4-(oxomethylidene)thiophene-3-carboxylate (PubChem CID 176531550) has the molecular formula C15H15NO3S and a molecular weight of 289.36 g/mol. Its IUPAC name is methyl 2-(3,4-dimethylanilino)-4-(oxomethylidene)thiophene-3-carboxylate.
| Compound Name | methyl 2-(3,4-dimethylanilino)-4-(oxomethylidene)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 176531550 |
| Molecular Formula | C15H15NO3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | methyl 2-(3,4-dimethylanilino)-4-(oxomethylidene)thiophene-3-carboxylate |
| SMILES | COC(=O)C1=C(Nc2ccc(C)c(C)c2)SCC1=C=O |
| InChI | InChI=1S/C15H15NO3S/c1-9-4-5-12(6-10(9)2)16-14-13(15(18)19-3)11(7-17)8-20-14/h4-6,16H,8H2,1-3H3 |
| InChIKey | KARIEWWYUNXJPD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|