C20H17NO3S — CID 176531552
cyclopropylmethyl 2-(naphthalen-2-ylamino)-4-(oxomethylidene)thiophene-3-carboxylate (PubChem CID 176531552) has the molecular formula C20H17NO3S and a molecular weight of 351.43 g/mol. Its IUPAC name is cyclopropylmethyl 2-(naphthalen-2-ylamino)-4-(oxomethylidene)thiophene-3-carboxylate.
| Compound Name | cyclopropylmethyl 2-(naphthalen-2-ylamino)-4-(oxomethylidene)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 176531552 |
| Molecular Formula | C20H17NO3S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | cyclopropylmethyl 2-(naphthalen-2-ylamino)-4-(oxomethylidene)thiophene-3-carboxylate |
| SMILES | O=C=C1CSC(Nc2ccc3ccccc3c2)=C1C(=O)OCC1CC1 |
| InChI | InChI=1S/C20H17NO3S/c22-10-16-12-25-19(18(16)20(23)24-11-13-5-6-13)21-17-8-7-14-3-1-2-4-15(14)9-17/h1-4,7-9,13,21H,5-6,11-12H2 |
| InChIKey | HGEDCJVEEOIIRK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|