C25H29N3O5 — CID 176533978
tert-butyl N-[2-[(1-ethenylcyclobutyl)carbamoyl]-4-(oxomethylidene)-3-phenylmethoxy-1-pyridinyl]carbamate (PubChem CID 176533978) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is tert-butyl N-[2-[(1-ethenylcyclobutyl)carbamoyl]-4-(oxomethylidene)-3-phenylmethoxy-1-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[2-[(1-ethenylcyclobutyl)carbamoyl]-4-(oxomethylidene)-3-phenylmethoxy-1-pyridinyl]carbamate |
|---|---|
| PubChem CID | 176533978 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | tert-butyl N-[2-[(1-ethenylcyclobutyl)carbamoyl]-4-(oxomethylidene)-3-phenylmethoxy-1-pyridinyl]carbamate |
| SMILES | C=CC1(NC(=O)C2=C(OCc3ccccc3)C(=C=O)C=CN2NC(=O)OC(C)(C)C)CCC1 |
| InChI | InChI=1S/C25H29N3O5/c1-5-25(13-9-14-25)26-22(30)20-21(32-17-18-10-7-6-8-11-18)19(16-29)12-15-28(20)27-23(31)33-24(2,3)4/h5-8,10-12,15H,1,9,13-14,17H2,2-4H3,(H,26,30)(H,27,31) |
| InChIKey | MZZHNXGMCNORLI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|