C11H17N5O5 — CID 176536503
9-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-2-imino-4,5-dihydro-3H-purin-6-one (PubChem CID 176536503) has the molecular formula C11H17N5O5 and a molecular weight of 299.29 g/mol. Its IUPAC name is 9-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-2-imino-4,5-dihydro-3H-purin-6-one.
| Compound Name | 9-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-2-imino-4,5-dihydro-3H-purin-6-one |
|---|---|
| PubChem CID | 176536503 |
| Molecular Formula | C11H17N5O5 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 9-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-2-imino-4,5-dihydro-3H-purin-6-one |
| SMILES | [H]/N=C1\NC(=O)C2N=CN([C@@H]3O[C@H](CO)[C@@H](O)[C@@]3(C)O)C2N1 |
| InChI | InChI=1S/C11H17N5O5/c1-11(20)6(18)4(2-17)21-9(11)16-3-13-5-7(16)14-10(12)15-8(5)19/h3-7,9,17-18,20H,2H2,1H3,(H3,12,14,15,19)/t4-,5?,6-,7?,9-,11-/m1/s1 |
| InChIKey | JLCFJTOTCLBDIM-GGXLSYPLSA-N |
| XLogP | -3.49 |
| TPSA | 150.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|