C12H17N5O5 — CID 91668372
(2R,3R,4R,5R)-5-(hydroxymethyl)-2-(2-imino-6-methoxy-5H-purin-9-yl)-3-methyloxolane-3,4-diol (PubChem CID 91668372) has the molecular formula C12H17N5O5 and a molecular weight of 311.30 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-(hydroxymethyl)-2-(2-imino-6-methoxy-5H-purin-9-yl)-3-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-5-(hydroxymethyl)-2-(2-imino-6-methoxy-5H-purin-9-yl)-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 91668372 |
| Molecular Formula | C12H17N5O5 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (2R,3R,4R,5R)-5-(hydroxymethyl)-2-(2-imino-6-methoxy-5H-purin-9-yl)-3-methyloxolane-3,4-diol |
| SMILES | [H]/N=C1\N=C(OC)C2N=CN([C@@H]3O[C@H](CO)[C@@H](O)[C@@]3(C)O)C2=N1 |
| InChI | InChI=1S/C12H17N5O5/c1-12(20)7(19)5(3-18)22-10(12)17-4-14-6-8(17)15-11(13)16-9(6)21-2/h4-7,10,13,18-20H,3H2,1-2H3/b13-11-/t5-,6?,7-,10-,12-/m1/s1 |
| InChIKey | UOXGHFYCPXJZRW-TWXYPASPSA-N |
| XLogP | -2.08 |
| TPSA | 143.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|