C10H16N6O5 — CID 176522373
3-[(2S,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-6-imino-5,8a-dihydro-1H-[1,2,4]triazolo[3,4-f][1,2,4]triazin-8-one (PubChem CID 176522373) has the molecular formula C10H16N6O5 and a molecular weight of 300.28 g/mol. Its IUPAC name is 3-[(2S,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-6-imino-5,8a-dihydro-1H-[1,2,4]triazolo[3,4-f][1,2,4]triazin-8-one.
| Compound Name | 3-[(2S,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-6-imino-5,8a-dihydro-1H-[1,2,4]triazolo[3,4-f][1,2,4]triazin-8-one |
|---|---|
| PubChem CID | 176522373 |
| Molecular Formula | C10H16N6O5 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 3-[(2S,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-6-imino-5,8a-dihydro-1H-[1,2,4]triazolo[3,4-f][1,2,4]triazin-8-one |
| SMILES | [H]/N=C1\NC(=O)C2NN=C([C@@H]3O[C@H](CO)[C@@H](O)[C@@]3(C)O)N2N1 |
| InChI | InChI=1S/C10H16N6O5/c1-10(20)4(18)3(2-17)21-5(10)6-13-14-7-8(19)12-9(11)15-16(6)7/h3-5,7,14,17-18,20H,2H2,1H3,(H3,11,12,15,19)/t3-,4-,5+,7?,10-/m1/s1 |
| InChIKey | YBMVANKKUWKANX-MTZIDLBNSA-N |
| XLogP | -4.03 |
| TPSA | 162.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | -4.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|