C22H18O7Ru — CID 176536967
1-(4-hydroxy-3-methoxyphenyl)-7-[4-hydroxy-3-(2-oxoethenoxy)phenyl]hepta-1,6-diene-3,5-dione;ruthenium (PubChem CID 176536967) has the molecular formula C22H18O7Ru and a molecular weight of 495.45 g/mol. Its IUPAC name is 1-(4-hydroxy-3-methoxyphenyl)-7-[4-hydroxy-3-(2-oxoethenoxy)phenyl]hepta-1,6-diene-3,5-dione;ruthenium.
| Compound Name | 1-(4-hydroxy-3-methoxyphenyl)-7-[4-hydroxy-3-(2-oxoethenoxy)phenyl]hepta-1,6-diene-3,5-dione;ruthenium |
|---|---|
| PubChem CID | 176536967 |
| Molecular Formula | C22H18O7Ru |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 496.01 |
| IUPAC Name | 1-(4-hydroxy-3-methoxyphenyl)-7-[4-hydroxy-3-(2-oxoethenoxy)phenyl]hepta-1,6-diene-3,5-dione;ruthenium |
| SMILES | COc1cc(C=CC(=O)CC(=O)C=Cc2ccc(O)c(OC=C=O)c2)ccc1O.[Ru] |
| InChI | InChI=1S/C22H18O7.Ru/c1-28-21-12-15(4-8-19(21)26)2-6-17(24)14-18(25)7-3-16-5-9-20(27)22(13-16)29-11-10-23;/h2-9,11-13,26-27H,14H2,1H3; |
| InChIKey | WHDYHGDIFVRDFL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|