C16H40N12 — CID 176538170
1-carbamimidamidoguanidine;1-(diaminomethylideneamino)-1-dodecylguanidine (PubChem CID 176538170) has the molecular formula C16H40N12 and a molecular weight of 400.58 g/mol. Its IUPAC name is 1-carbamimidamidoguanidine;1-(diaminomethylideneamino)-1-dodecylguanidine.
| Compound Name | 1-carbamimidamidoguanidine;1-(diaminomethylideneamino)-1-dodecylguanidine |
|---|---|
| PubChem CID | 176538170 |
| Molecular Formula | C16H40N12 |
| Molecular Weight | 400.58 g/mol |
| Exact Mass | 400.35 |
| IUPAC Name | 1-carbamimidamidoguanidine;1-(diaminomethylideneamino)-1-dodecylguanidine |
| SMILES | [H]/N=C(\N)N(CCCCCCCCCCCC)N=C(N)N.[H]/N=C(\N)NN/C(N)=N/[H] |
| InChI | InChI=1S/C14H32N6.C2H8N6/c1-2-3-4-5-6-7-8-9-10-11-12-20(14(17)18)19-13(15)16;3-1(4)7-8-2(5)6/h2-12H2,1H3,(H3,17,18)(H4,15,16,19);(H4,3,4,7)(H4,5,6,8) |
| InChIKey | JFUBRNAFMMJJFH-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 241.31 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.58 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|