C12H27N7O2 — CID 176537261
5-carbamimidamido-2-[(diaminomethylideneamino)-pentylamino]pentanoic acid (PubChem CID 176537261) has the molecular formula C12H27N7O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 5-carbamimidamido-2-[(diaminomethylideneamino)-pentylamino]pentanoic acid.
| Compound Name | 5-carbamimidamido-2-[(diaminomethylideneamino)-pentylamino]pentanoic acid |
|---|---|
| PubChem CID | 176537261 |
| Molecular Formula | C12H27N7O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | 5-carbamimidamido-2-[(diaminomethylideneamino)-pentylamino]pentanoic acid |
| SMILES | [H]/N=C(\N)NCCCC(C(=O)O)N(CCCCC)N=C(N)N |
| InChI | InChI=1S/C12H27N7O2/c1-2-3-4-8-19(18-12(15)16)9(10(20)21)6-5-7-17-11(13)14/h9H,2-8H2,1H3,(H,20,21)(H4,13,14,17)(H4,15,16,18) |
| InChIKey | DYHFFOXZZKKETA-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 166.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|