C9H17N3O2 — CID 176548506
N-acetyl-2,3-bis(dimethylamino)prop-2-enamide (PubChem CID 176548506) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is N-acetyl-2,3-bis(dimethylamino)prop-2-enamide.
| Compound Name | N-acetyl-2,3-bis(dimethylamino)prop-2-enamide |
|---|---|
| PubChem CID | 176548506 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | N-acetyl-2,3-bis(dimethylamino)prop-2-enamide |
| SMILES | CC(=O)NC(=O)C(=CN(C)C)N(C)C |
| InChI | InChI=1S/C9H17N3O2/c1-7(13)10-9(14)8(12(4)5)6-11(2)3/h6H,1-5H3,(H,10,13,14) |
| InChIKey | JGQHBTJOQHXZCY-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|