C27H34F2N2O4SSi — CID 176549830
7-[1,1-difluoro-3-tri(propan-2-yl)silylprop-2-ynyl]-N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-2-methoxyquinoline-3-carboxamide (PubChem CID 176549830) has the molecular formula C27H34F2N2O4SSi and a molecular weight of 548.73 g/mol. Its IUPAC name is 7-[1,1-difluoro-3-tri(propan-2-yl)silylprop-2-ynyl]-N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-2-methoxyquinoline-3-carboxamide.
| Compound Name | 7-[1,1-difluoro-3-tri(propan-2-yl)silylprop-2-ynyl]-N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-2-methoxyquinoline-3-carboxamide |
|---|---|
| PubChem CID | 176549830 |
| Molecular Formula | C27H34F2N2O4SSi |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | 7-[1,1-difluoro-3-tri(propan-2-yl)silylprop-2-ynyl]-N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-2-methoxyquinoline-3-carboxamide |
| SMILES | COc1nc2cc(C(F)(F)C#C[Si](C(C)C)(C(C)C)C(C)C)ccc2cc1C(=O)N[C@@H]1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C27H34F2N2O4SSi/c1-17(2)37(18(3)4,19(5)6)13-11-27(28,29)21-9-8-20-14-23(26(35-7)31-24(20)15-21)25(32)30-22-10-12-36(33,34)16-22/h8-10,12,14-15,17-19,22H,16H2,1-7H3,(H,30,32)/t22-/m1/s1 |
| InChIKey | LNHJYNWTSMUANQ-JOCHJYFZSA-N |
| XLogP | 5.60 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|