C22H40O3 — CID 176553148
butane;ethane;4-[2-(3-hydroxy-3-methylbutoxy)-2-methylpropyl]benzaldehyde (PubChem CID 176553148) has the molecular formula C22H40O3 and a molecular weight of 352.56 g/mol. Its IUPAC name is butane;ethane;4-[2-(3-hydroxy-3-methylbutoxy)-2-methylpropyl]benzaldehyde.
| Compound Name | butane;ethane;4-[2-(3-hydroxy-3-methylbutoxy)-2-methylpropyl]benzaldehyde |
|---|---|
| PubChem CID | 176553148 |
| Molecular Formula | C22H40O3 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.30 |
| IUPAC Name | butane;ethane;4-[2-(3-hydroxy-3-methylbutoxy)-2-methylpropyl]benzaldehyde |
| SMILES | CC.CC(C)(O)CCOC(C)(C)Cc1ccc(C=O)cc1.CCCC |
| InChI | InChI=1S/C16H24O3.C4H10.C2H6/c1-15(2,18)9-10-19-16(3,4)11-13-5-7-14(12-17)8-6-13;1-3-4-2;1-2/h5-8,12,18H,9-11H2,1-4H3;3-4H2,1-2H3;1-2H3 |
| InChIKey | HJJQXUNSJLLGIZ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|