C15H14F3N5O — CID 176553328
5-methanimidoyl-N-[4-methyl-5-(trifluoromethyl)pyrimidin-2-yl]-3,4-dihydro-2H-1,4-benzoxazin-6-amine (PubChem CID 176553328) has the molecular formula C15H14F3N5O and a molecular weight of 337.31 g/mol. Its IUPAC name is 5-methanimidoyl-N-[4-methyl-5-(trifluoromethyl)pyrimidin-2-yl]-3,4-dihydro-2H-1,4-benzoxazin-6-amine.
| Compound Name | 5-methanimidoyl-N-[4-methyl-5-(trifluoromethyl)pyrimidin-2-yl]-3,4-dihydro-2H-1,4-benzoxazin-6-amine |
|---|---|
| PubChem CID | 176553328 |
| Molecular Formula | C15H14F3N5O |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 5-methanimidoyl-N-[4-methyl-5-(trifluoromethyl)pyrimidin-2-yl]-3,4-dihydro-2H-1,4-benzoxazin-6-amine |
| SMILES | [H]/N=C/c1c(Nc2ncc(C(F)(F)F)c(C)n2)ccc2c1NCCO2 |
| InChI | InChI=1S/C15H14F3N5O/c1-8-10(15(16,17)18)7-21-14(22-8)23-11-2-3-12-13(9(11)6-19)20-4-5-24-12/h2-3,6-7,19-20H,4-5H2,1H3,(H,21,22,23)/b19-6+ |
| InChIKey | IRFWNEZDVUYWMQ-KPSZGOFPSA-N |
| XLogP | 3.35 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|