C11H20N4O — CID 176554112
(2Z)-2,5,5-triamino-N-cyclohexylpenta-2,4-dienamide (PubChem CID 176554112) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is (2Z)-2,5,5-triamino-N-cyclohexylpenta-2,4-dienamide.
| Compound Name | (2Z)-2,5,5-triamino-N-cyclohexylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 176554112 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | (2Z)-2,5,5-triamino-N-cyclohexylpenta-2,4-dienamide |
| SMILES | NC(N)=C/C=C(\N)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C11H20N4O/c12-9(6-7-10(13)14)11(16)15-8-4-2-1-3-5-8/h6-8H,1-5,12-14H2,(H,15,16)/b9-6- |
| InChIKey | GKLVXKMLXFZGLA-TWGQIWQCSA-N |
| XLogP | 0.04 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|