C10H11FN2O3 — CID 176555769
N-[3-fluoro-4-(hydroxymethyl)phenyl]-2-formamidoacetamide (PubChem CID 176555769) has the molecular formula C10H11FN2O3 and a molecular weight of 226.21 g/mol. Its IUPAC name is N-[3-fluoro-4-(hydroxymethyl)phenyl]-2-formamidoacetamide.
| Compound Name | N-[3-fluoro-4-(hydroxymethyl)phenyl]-2-formamidoacetamide |
|---|---|
| PubChem CID | 176555769 |
| Molecular Formula | C10H11FN2O3 |
| Molecular Weight | 226.21 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | N-[3-fluoro-4-(hydroxymethyl)phenyl]-2-formamidoacetamide |
| SMILES | O=CNCC(=O)Nc1ccc(CO)c(F)c1 |
| InChI | InChI=1S/C10H11FN2O3/c11-9-3-8(2-1-7(9)5-14)13-10(16)4-12-6-15/h1-3,6,14H,4-5H2,(H,12,15)(H,13,16) |
| InChIKey | YSLUAQHHINFYQZ-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.21 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|