C20H32FN3O5 — CID 176555768
tert-butyl N-(3-methylbutan-2-yl)carbamate;N-[3-fluoro-4-(hydroxymethyl)phenyl]-2-formamidoacetamide (PubChem CID 176555768) has the molecular formula C20H32FN3O5 and a molecular weight of 413.49 g/mol. Its IUPAC name is tert-butyl N-(3-methylbutan-2-yl)carbamate;N-[3-fluoro-4-(hydroxymethyl)phenyl]-2-formamidoacetamide.
| Compound Name | tert-butyl N-(3-methylbutan-2-yl)carbamate;N-[3-fluoro-4-(hydroxymethyl)phenyl]-2-formamidoacetamide |
|---|---|
| PubChem CID | 176555768 |
| Molecular Formula | C20H32FN3O5 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | tert-butyl N-(3-methylbutan-2-yl)carbamate;N-[3-fluoro-4-(hydroxymethyl)phenyl]-2-formamidoacetamide |
| SMILES | CC(C)C(C)NC(=O)OC(C)(C)C.O=CNCC(=O)Nc1ccc(CO)c(F)c1 |
| InChI | InChI=1S/C10H11FN2O3.C10H21NO2/c11-9-3-8(2-1-7(9)5-14)13-10(16)4-12-6-15;1-7(2)8(3)11-9(12)13-10(4,5)6/h1-3,6,14H,4-5H2,(H,12,15)(H,13,16);7-8H,1-6H3,(H,11,12) |
| InChIKey | PSMFJCIABXQYFS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|