C9H16N2 — CID 176556944
2,4-dimethyl-4H-1,3-diazepine;ethane (PubChem CID 176556944) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 2,4-dimethyl-4H-1,3-diazepine;ethane.
| Compound Name | 2,4-dimethyl-4H-1,3-diazepine;ethane |
|---|---|
| PubChem CID | 176556944 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 2,4-dimethyl-4H-1,3-diazepine;ethane |
| SMILES | CC.CC1=NC(C)C=CC=N1 |
| InChI | InChI=1S/C7H10N2.C2H6/c1-6-4-3-5-8-7(2)9-6;1-2/h3-6H,1-2H3;1-2H3 |
| InChIKey | IRMYPPIFVCKVHD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |