C24H32Cl2N6O3 — CID 176557873
6-amino-N-[2-[3-[6,7-dichloro-2-(2-hydroxyacetyl)-1,3,4,5,9,9a-hexahydropyrido[4,3-b]indol-9-yl]pyrazol-1-yl]ethyl]hexanamide (PubChem CID 176557873) has the molecular formula C24H32Cl2N6O3 and a molecular weight of 523.47 g/mol. Its IUPAC name is 6-amino-N-[2-[3-[6,7-dichloro-2-(2-hydroxyacetyl)-1,3,4,5,9,9a-hexahydropyrido[4,3-b]indol-9-yl]pyrazol-1-yl]ethyl]hexanamide.
| Compound Name | 6-amino-N-[2-[3-[6,7-dichloro-2-(2-hydroxyacetyl)-1,3,4,5,9,9a-hexahydropyrido[4,3-b]indol-9-yl]pyrazol-1-yl]ethyl]hexanamide |
|---|---|
| PubChem CID | 176557873 |
| Molecular Formula | C24H32Cl2N6O3 |
| Molecular Weight | 523.47 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 6-amino-N-[2-[3-[6,7-dichloro-2-(2-hydroxyacetyl)-1,3,4,5,9,9a-hexahydropyrido[4,3-b]indol-9-yl]pyrazol-1-yl]ethyl]hexanamide |
| SMILES | NCCCCCC(=O)NCCn1ccc(C2C=C(Cl)C(Cl)=C3NC4=C(CN(C(=O)CO)CC4)C32)n1 |
| InChI | InChI=1S/C24H32Cl2N6O3/c25-17-12-15(19-6-10-32(30-19)11-8-28-20(34)4-2-1-3-7-27)22-16-13-31(21(35)14-33)9-5-18(16)29-24(22)23(17)26/h6,10,12,15,22,29,33H,1-5,7-9,11,13-14,27H2,(H,28,34) |
| InChIKey | UBLOPBWPYXNNIN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 125.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.47 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|