C21H26Cl2N6O3 — CID 172580066
N-(3-aminopropyl)-2-[3-[6,7-dichloro-2-(2-hydroxyacetyl)-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indol-9-yl]pyrazol-1-yl]acetamide (PubChem CID 172580066) has the molecular formula C21H26Cl2N6O3 and a molecular weight of 481.38 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-[3-[6,7-dichloro-2-(2-hydroxyacetyl)-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indol-9-yl]pyrazol-1-yl]acetamide.
| Compound Name | N-(3-aminopropyl)-2-[3-[6,7-dichloro-2-(2-hydroxyacetyl)-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indol-9-yl]pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 172580066 |
| Molecular Formula | C21H26Cl2N6O3 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | N-(3-aminopropyl)-2-[3-[6,7-dichloro-2-(2-hydroxyacetyl)-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indol-9-yl]pyrazol-1-yl]acetamide |
| SMILES | NCCCNC(=O)Cn1ccc(-c2cc(Cl)c(Cl)c3c2C2CN(C(=O)CO)CCC2N3)n1 |
| InChI | InChI=1S/C21H26Cl2N6O3/c22-14-8-12(16-3-7-29(27-16)10-17(31)25-5-1-4-24)19-13-9-28(18(32)11-30)6-2-15(13)26-21(19)20(14)23/h3,7-8,13,15,26,30H,1-2,4-6,9-11,24H2,(H,25,31) |
| InChIKey | HXDFKHDKUFZMID-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 125.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|