C17H27N3O4 — CID 176559725
methyl 2-[5-[8-aminooctyl(formyl)amino]-2-oxo-1-pyridinyl]acetate (PubChem CID 176559725) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is methyl 2-[5-[8-aminooctyl(formyl)amino]-2-oxo-1-pyridinyl]acetate.
| Compound Name | methyl 2-[5-[8-aminooctyl(formyl)amino]-2-oxo-1-pyridinyl]acetate |
|---|---|
| PubChem CID | 176559725 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | methyl 2-[5-[8-aminooctyl(formyl)amino]-2-oxo-1-pyridinyl]acetate |
| SMILES | COC(=O)Cn1cc(N(C=O)CCCCCCCCN)ccc1=O |
| InChI | InChI=1S/C17H27N3O4/c1-24-17(23)13-20-12-15(8-9-16(20)22)19(14-21)11-7-5-3-2-4-6-10-18/h8-9,12,14H,2-7,10-11,13,18H2,1H3 |
| InChIKey | SBAHGJAMMNAVBG-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 94.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|