C31H43N5O4 — CID 176559724
methyl 2-[5-[8-aminooctyl(formyl)amino]-2-oxo-1-pyridinyl]acetate;4-piperidin-1-ylisoquinoline (PubChem CID 176559724) has the molecular formula C31H43N5O4 and a molecular weight of 549.72 g/mol. Its IUPAC name is methyl 2-[5-[8-aminooctyl(formyl)amino]-2-oxo-1-pyridinyl]acetate;4-piperidin-1-ylisoquinoline.
| Compound Name | methyl 2-[5-[8-aminooctyl(formyl)amino]-2-oxo-1-pyridinyl]acetate;4-piperidin-1-ylisoquinoline |
|---|---|
| PubChem CID | 176559724 |
| Molecular Formula | C31H43N5O4 |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.33 |
| IUPAC Name | methyl 2-[5-[8-aminooctyl(formyl)amino]-2-oxo-1-pyridinyl]acetate;4-piperidin-1-ylisoquinoline |
| SMILES | COC(=O)Cn1cc(N(C=O)CCCCCCCCN)ccc1=O.c1ccc2c(N3CCCCC3)cncc2c1 |
| InChI | InChI=1S/C17H27N3O4.C14H16N2/c1-24-17(23)13-20-12-15(8-9-16(20)22)19(14-21)11-7-5-3-2-4-6-10-18;1-4-8-16(9-5-1)14-11-15-10-12-6-2-3-7-13(12)14/h8-9,12,14H,2-7,10-11,13,18H2,1H3;2-3,6-7,10-11H,1,4-5,8-9H2 |
| InChIKey | LQIXQXKDIIUQKY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 110.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|