C34H45N7O8 — CID 169214424
ethyl 2-[5-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethyl-[(3S)-1-isoquinolin-4-ylpiperidine-3-carbonyl]amino]-2-oxo-1-pyridinyl]acetate (PubChem CID 169214424) has the molecular formula C34H45N7O8 and a molecular weight of 679.77 g/mol. Its IUPAC name is ethyl 2-[5-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethyl-[(3S)-1-isoquinolin-4-ylpiperidine-3-carbonyl]amino]-2-oxo-1-pyridinyl]acetate.
| Compound Name | ethyl 2-[5-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethyl-[(3S)-1-isoquinolin-4-ylpiperidine-3-carbonyl]amino]-2-oxo-1-pyridinyl]acetate |
|---|---|
| PubChem CID | 169214424 |
| Molecular Formula | C34H45N7O8 |
| Molecular Weight | 679.77 g/mol |
| Exact Mass | 679.33 |
| IUPAC Name | ethyl 2-[5-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethyl-[(3S)-1-isoquinolin-4-ylpiperidine-3-carbonyl]amino]-2-oxo-1-pyridinyl]acetate |
| SMILES | CCOC(=O)Cn1cc(N(CCOCCOCCOCCOCCN=[N+]=[N-])C(=O)[C@H]2CCCN(c3cncc4ccccc34)C2)ccc1=O |
| InChI | InChI=1S/C34H45N7O8/c1-2-49-33(43)26-40-25-29(9-10-32(40)42)41(13-15-46-17-19-48-21-20-47-18-16-45-14-11-37-38-35)34(44)28-7-5-12-39(24-28)31-23-36-22-27-6-3-4-8-30(27)31/h3-4,6,8-10,22-23,25,28H,2,5,7,11-21,24,26H2,1H3/t28-/m0/s1 |
| InChIKey | MCTNMRZOEOQUNH-NDEPHWFRSA-N |
| XLogP | 3.59 |
| TPSA | 170.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.77 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|