C22H35N3O3 — CID 176559905
1-[2-[2-[(3Z)-3-(dimethylamino)-2-(2,3-dimethylphenyl)hexa-3,5-dienoxy]ethoxy]ethyl]-3-methylurea (PubChem CID 176559905) has the molecular formula C22H35N3O3 and a molecular weight of 389.54 g/mol. Its IUPAC name is 1-[2-[2-[(3Z)-3-(dimethylamino)-2-(2,3-dimethylphenyl)hexa-3,5-dienoxy]ethoxy]ethyl]-3-methylurea.
| Compound Name | 1-[2-[2-[(3Z)-3-(dimethylamino)-2-(2,3-dimethylphenyl)hexa-3,5-dienoxy]ethoxy]ethyl]-3-methylurea |
|---|---|
| PubChem CID | 176559905 |
| Molecular Formula | C22H35N3O3 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | 1-[2-[2-[(3Z)-3-(dimethylamino)-2-(2,3-dimethylphenyl)hexa-3,5-dienoxy]ethoxy]ethyl]-3-methylurea |
| SMILES | C=C/C=C(/C(COCCOCCNC(=O)NC)c1cccc(C)c1C)N(C)C |
| InChI | InChI=1S/C22H35N3O3/c1-7-9-21(25(5)6)20(19-11-8-10-17(2)18(19)3)16-28-15-14-27-13-12-24-22(26)23-4/h7-11,20H,1,12-16H2,2-6H3,(H2,23,24,26)/b21-9- |
| InChIKey | ANPGUZSVDREZFF-NKVSQWTQSA-N |
| XLogP | 2.98 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|